Voir la source de Énanthate de noréthistérone

{{Infobox Chimie
 | nom = Énanthate de noréthistérone
 | image = Norethindrone enanthate.svg
 | image2 = 
 | taille image = 225
 | légende = Structure de l'énanthate de noréthistérone
<!-- Général -->
 | DCI = 
 | nomIUPAC = heptanoate de (8''R'',9''S'',10''R'',13''S'',14''S'',17''R'')-17-éthynyl-13-méthyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodécahydrocyclopenta[a]phénanthrèn-17-yle
 | synonymes = énanthate de noréthindrone
 | CAS = {{CAS|3|8|3|6|2|3|5}}
 | EINECS = {{EINECS|2|2|3|3|2|6|7}}
 | RTECS = {{RTECS|}}
 | ATC = {{ATC|}} {{ATCvet|}}
 | DrugBank = 
 | PubChem = {{CID|229295}}{{SID|}}
 | chEBI = 
 | NrE = {{NrE|}}
 | FEMA = {{FEMA|}}
 | SMILES = CCCCCCC(=O)O[C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@H]34)C)C#C
 | InChI = 
 | InChIKey = 
 | StdInChI = 1S/C27H38O3/c1-4-6-7-8-9-25(29)30-27(5-2)17-15-24-23-12-10-19-18-20(28)11-13-21(19)22(23)14-16-26(24,27)3/h2,18,21-24H,4,6-17H2,1,3H3/t21-,22+,23+,24-,26-,27-/m0/s1
 | StdInChIKey = APTGJECXMIKIET-WOSSHHRXSA-N
 | apparence = 
<!-- Propriétés chimiques -->
 | formule = |C=27|H=38|O=3
 | masseMol = 
 | pKa = {{pKa||T(°C)=|T(K)=}}
 | momentDipolaire = {{unité/2||D}}
 | susceptibiliteMagnetique = 
 | diametreMoleculaire = {{unité/2||nm}}
 | indiceIode = 
 | indiceAcide = 
 | indiceSaponification = 
<!-- Propriétés physiques -->
 | TTransitionVitreuse = {{tmp||°C}}
 | fusion = {{tmp||°C}}
 | ebullition = {{tmp||°C}}
 | solubilite = {{Unité/2||g||L|-1}}
 | parametreSolubilite = <!-- {{Unité/2||MPa|1/2}} ({{température||°C}}) -->
 | miscibilite = 
 | masseVolumique = {{Unité/2||g||cm|-3}}
 | TAutoInflammation = {{tmp||°C}}
 | pointEclair = {{tmp||°C}}
 | limitesExplosivite = 
 | pressionVapeur = 
 | viscosite = 
 | pointCritique = 
 | pointTriple = 
 | conductivitéThermique = {{Unité/2||W||m|-1|K|-1}}
 | conductivitéÉlectrique = 
 | vitesseSon = {{Unité/2||m||s|-1}}
<!-- Thermochimie -->
 | emsGaz = {{Unité/2||J||K|-1|mol|-1}}
 | emsLiquide = {{Unité/2||J||K|-1|mol|-1}}
 | emsSolide = {{Unité/2||J||K|-1|mol|-1}}
 | esfGaz = {{Unité/2||kJ||mol|-1}}
 | esfLiquide = {{Unité/2||kJ||mol|-1}}
 | esfSolide = {{Unité/2||kJ||mol|-1}}
 | enthFus = 
 | enthVap = 
 | capaciteTherm = {{Unité/2||J||K|-1|mol|-1}}
 | PCS = 
 | PCI = 
<!-- Propriétés biochimiques -->
 | codons = 
 | pHisoelectrique = 
 | acideAmineEss = 
<!-- Propriétés électroniques -->
 | bandeInterdite = 
 | mobiliteElectronique = 
 | mobiliteTrous = 
 | 1reEnergieIonisation = 
 | constanteDielectrique = 
<!-- Cristallographie -->
 | systemeCristallin = 
 | reseauBravais = 
 | Pearson = {{SymbolePearson|}}
 | classe = {{Infobox Chimie/Groupe espace||ref=}}
 | Schoenflies = 
 | Strukturbericht = 
 | structureType = 
 | parametresMaille = 
 | volume = 
 | macle = 
<!-- Propriétés optiques -->
 | refraction = {{réfraction|T=|λ=|}}
 | birefringence = 
 | dispersion = 
 | polychroisme = 
 | fluorescence = <!-- λ<sub>excitation</sub> {{λ||nm}} ; <br />λ<sub>émission</sub> {{λ||nm}} -->
 | absorption = 
 | transparence = 
 | pvrRotatoire = <!-- <math>\lbrack\alpha\rbrack_{D}^{25}</math> -->
 | cteVerdet = 
<!-- Précautions -->
 | radioactif = 
 | 67548EEC = 
 | 67548EECref = 
 | symboles = 
 | numeroIndex = {{indexCE|}}
 | classificationCE = 
 | r = 
 | s = 
 | transportRef = 
 | transport = {{ADR|Kemler=|ONU=|Classe=|CodeClassification=|Etiquette=|Etiquette2=|Etiquette3=|Emballage=}}
 | NFPA704ref = 
 | NFPA704 = {{NFPA 704|Health=|Flammability=|Reactivity=|Other=}}
 | SIMDUTref = 
 | SIMDUT = {{SIMDUT|}}
 | SGHref = 
 | SGH = {{SGH|}}
 | CIRC = 
 | inhalation = 
 | peau = 
 | yeux = 
 | ingestion = 
<!-- Écotoxicologie -->
 | DL50 = <!-- {{Unité/2||mg||kg|-1}} (souris, [[Ingestion|oral]]) <br /> (souris, [[Injection intraveineuse|i.v.]]) <br /> (souris, [[sous-cutané|s.c.]]) <br /> (souris, [[intrapéritonéal|i.p.]]) -->
 | CL50 = 
 | LogP = 
 | DJA = 
 | odorat = 
<!-- Données pharmacocinétiques -->
 | CAM = 
 | biodisponibilite = 
 | liaisonProteique = 
 | metabolisme = 
 | demiVieDistrib = 
 | demiVieElim = 
 | stockage = 
 | excretion = 
<!-- Considérations thérapeutiques -->
 | classeTherapeutique = 
 | voieAdministration = 
 | grossesse = 
 | conduiteAuto = 
 | precautions = 
 | antidote = 
<!-- Caractère psychotrope -->
 | categoriePsycho = 
 | modeConsommation = 
 | autresNoms = 
 | risqueDependance = 
<!-- Composés apparentés -->
 | autres = 
 | autrescations = 
 | autresanions = 
 | isomères = 
<!-- Supplément -->
 | supplement = 
}}<!-- ----------------------------- Fin de l'infoboîte ----------------------------- -->
L''''énanthate de noréthistérone''' est l'[[ester]] de [[noréthistérone]] et d'[[acide heptanoïque]] (énanthate). Il s'agit d'un [[progestatif de synthèse]] ayant des effets {{lien|fr=Antigonadotrope|lang=en|trad=Antigonadotropin|texte=antigonadotropes}} (à la fois [[anti-androgène]] et {{lien|fr=anti-œstrogène|lang=en|trad=Antiestrogen}})<ref name="10.1016/0960-0760(91)90406-U">
{{Article
 | langue      = en
 | nom1        = J. Garza-Flores, M. Menjívar, M. Cardenas, M. Reynoso, G.A. García et G. Pérez Palacios
 | titre       = Further studies on the antigonadotropic mechanism of action of norethisterone
 | périodique  = The Journal of Steroid Biochemistry and Molecular Biology
 | volume      = 38
 | numéro      = 1
 | jour        = 
 | mois        = janvier
 | année       = 1991
 | pages       = 89-93
 | url texte   = http://www.sciencedirect.com/science/article/pii/096007609190406U
 | consulté le = 18 mai 2014
 | doi         = 10.1016/0960-0760(91)90406-U
 | pmid        = 1825472
 | pmc         = 
}}</ref> et utilisé comme [[Contraception hormonale|contraceptif hormonal]]<ref name="978-0-412-46630-4">
{{Ouvrage|langue=en|auteur1=F.. Macdonald|titre=Dictionary of Pharmacological Agents|éditeur=[[CRC Press]]|année=1997|pages totales=2700|passage=1450|isbn=978-0-412-46630-4|lire en ligne=https://books.google.com/books?id=A0THacd46ZsC&pg=PA1450|consulté le=12 mai 2012}}</ref>{{,}}<ref name="978-3-88763-075-1">
{{Ouvrage|langue=en|titre=Index Nominum 2000|sous-titre=International Drug Directory|éditeur=Taylor & Francis US|année=2000|pages totales=1932|passage=750|isbn=978-3-88763-075-1|lire en ligne=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA750|consulté le=30 mai 2012}}</ref>.

Il fait partie de la liste des médicaments essentiels de l'[[Organisation mondiale de la santé]] (liste mise à jour en {{date-|avril 2013}})<ref>[http://apps.who.int/iris/bitstream/10665/93142/1/EML_18_eng.pdf?ua=1 WHO&nbsp;Model&nbsp;List&nbsp;of&nbsp;Essential&nbsp;Medicines, 18th&nbsp;list], avril 2013</ref>.

== Notes et références ==
{{Références}}

{{Portail|chimie|pharmacie}}

[[Catégorie:3-oxostéroïde]]
[[Catégorie:Énone]]
[[Catégorie:Alcyne]]
[[Catégorie:Ester heptanoïque]]
[[Catégorie:Médicament essentiel listé par l'OMS]]