Voir la source de Adénylyl-imidodiphosphate

{{Infobox Chimie
 | nom = Adénylyl-imidodiphosphate
 | image = 
 | image2 = 
 | taille image = 200
 | légende = [[Fichier:Adenosylyl imidodiphosphate.png|225px]]<br>Structure de l'adénosylyl-imidodiphosphate
<!-- Général -->
 | DCI = 
 | nomIUPAC = 5'-''O''-(hydroxy{[hydroxy(phosphono<br>amino)phosphoryl]oxy}phosphoryl)<br>adénosine 
 | synonymes = adényl-5'-yl-imidodiphosphate<br>''gamma''-imino-ATP<br>AMP-PNP
 | CAS = {{CAS|2|5|6|1|2|7|3|1}}
 | EINECS = {{EINECS|}}
 | RTECS = {{RTECS|}}
 | ATC = {{ATC|}} {{ATCvet|}}
 | DrugBank = 
 | PubChem = {{CID|33113}}{{SID|}}
 | chEBI = 47785
 | NrE = {{NrE|}}
 | FEMA = {{FEMA|}}
 | SMILES = Nc1ncnc2n(cnc12)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)NP(O)(O)=O)[C@@H](O)[C@H]1O
 | InChI = 
 | InChIKey = 
 | StdInChI = 1S/C10H17N6O12P3/c11-8-5-9(13-2-12-8)16(3-14-5)10-7(18)6(17)4(27-10)1-26-31(24,25)28-30(22,23)15-29(19,20)21/h2-4,6-7,10,17-18H,1H2,(H,24,25)(H2,11,12,13)(H4,15,19,20,21,22,23)/t4-,6-,7-,10-/m1/s1
 | StdInChIKey = PVKSNHVPLWYQGJ-KQYNXXCUSA-N
 | apparence = 
<!-- Propriétés chimiques -->
 | formule = |C=10|H=17|N=6|O=12|P=3
 | masseMol = 
 | pKa = {{pKa||T(°C)=|T(K)=}}
 | momentDipolaire = {{unité/2||D}}
 | susceptibiliteMagnetique = 
 | diametreMoleculaire = {{unité/2||nm}}
 | indiceIode = 
 | indiceAcide = 
 | indiceSaponification = 
<!-- Propriétés physiques -->
 | TTransitionVitreuse = {{tmp||°C}}
 | fusion = {{tmp||°C}}
 | ebullition = {{tmp||°C}}
 | solubilite = {{Unité/2||g||L|-1}}
 | parametreSolubilite = <!-- {{Unité/2||MPa|1/2}} ({{température||°C}}) -->
 | miscibilite = 
 | masseVolumique = {{Unité/2||g||cm|-3}}
 | TAutoInflammation = {{tmp||°C}}
 | pointEclair = {{tmp||°C}}
 | limitesExplosivite = 
 | pressionVapeur = 
 | viscosite = 
 | pointCritique = 
 | pointTriple = 
 | conductivitéThermique = {{Unité/2||W||m|-1|K|-1}}
 | conductivitéÉlectrique = 
 | vitesseSon = {{Unité/2||m||s|-1}}
<!-- Thermochimie -->
 | emsGaz = {{Unité/2||J||K|-1|mol|-1}}
 | emsLiquide = {{Unité/2||J||K|-1|mol|-1}}
 | emsSolide = {{Unité/2||J||K|-1|mol|-1}}
 | esfGaz = {{Unité/2||kJ||mol|-1}}
 | esfLiquide = {{Unité/2||kJ||mol|-1}}
 | esfSolide = {{Unité/2||kJ||mol|-1}}
 | enthFus = 
 | enthVap = 
 | capaciteTherm = {{Unité/2||J||K|-1|mol|-1}}
 | PCS = 
 | PCI = 
<!-- Propriétés biochimiques -->
 | codons = 
 | pHisoelectrique = 
 | acideAmineEss = 
<!-- Propriétés électroniques -->
 | bandeInterdite = 
 | mobiliteElectronique = 
 | mobiliteTrous = 
 | 1reEnergieIonisation = 
 | constanteDielectrique = 
<!-- Cristallographie -->
 | systemeCristallin = 
 | reseauBravais = 
 | Pearson = {{SymbolePearson|}}
 | classe = {{Infobox Chimie/Groupe espace||ref=}}
 | Schoenflies = 
 | Strukturbericht = 
 | structureType = 
 | parametresMaille = 
 | volume = 
 | macle = 
<!-- Propriétés optiques -->
 | refraction = {{réfraction|T=|λ=|}}
 | birefringence = 
 | dispersion = 
 | polychroisme = 
 | fluorescence = <!-- λ<sub>excitation</sub> {{λ||nm}} ; <br />λ<sub>émission</sub> {{λ||nm}} -->
 | absorption = 
 | transparence = 
 | pvrRotatoire = <!-- <math>\lbrack\alpha\rbrack_{D}^{25}</math> -->
 | cteVerdet = 
<!-- Précautions -->
 | radioactif = 
 | 67548EEC = 
 | 67548EECref = 
 | symboles = 
 | numeroIndex = {{indexCE|}}
 | classificationCE = 
 | r = 
 | s = 
 | transportRef = 
 | transport = {{ADR|Kemler=|ONU=|Classe=|CodeClassification=|Etiquette=|Etiquette2=|Etiquette3=|Emballage=}}
 | NFPA704ref = 
 | NFPA704 = {{NFPA 704|Health=|Flammability=|Reactivity=|Other=}}
 | SIMDUTref = 
 | SIMDUT = {{SIMDUT|}}
 | SGHref = 
 | SGH = {{SGH|}}
 | CIRC = 
 | inhalation = 
 | peau = 
 | yeux = 
 | ingestion = 
<!-- Écotoxicologie -->
 | DL50 = <!-- {{Unité/2||mg||kg|-1}} (souris, [[Ingestion|oral]]) <br /> (souris, [[Injection intraveineuse|i.v.]]) <br /> (souris, [[sous-cutané|s.c.]]) <br /> (souris, [[intrapéritonéal|i.p.]]) -->
 | CL50 = 
 | LogP = 
 | DJA = 
 | odorat = 
<!-- Données pharmacocinétiques -->
 | CAM = 
 | biodisponibilite = 
 | liaisonProteique = 
 | metabolisme = 
 | demiVieDistrib = 
 | demiVieElim = 
 | stockage = 
 | excretion = 
<!-- Considérations thérapeutiques -->
 | classeTherapeutique = 
 | voieAdministration = 
 | grossesse = 
 | conduiteAuto = 
 | precautions = 
 | antidote = 
<!-- Caractère psychotrope -->
 | categoriePsycho = 
 | modeConsommation = 
 | autresNoms = 
 | risqueDependance = 
<!-- Composés apparentés -->
 | autres = 
 | autrescations = 
 | autresanions = 
 | isomères = 
<!-- Supplément -->
 | supplement = 
}}<!-- ----------------------------- Fin de l'infoboîte ----------------------------- -->
L''''adénylyl-imidodiphosphate''' ('''AMP-PNP''') est un [[analogue structurel]] [[Hydrolyse|non hydrolysable]] de l'[[Adénosine triphosphate|ATP]]<ref name="10.1021/bi00789a009">
{{Article
 | langue      = en
 | nom1        = Ralph G. Yount, Donner Babcock, William Ballantyne et Deanna Ojala
 | titre       = Adenylyl imidiodiphosphate, an adenosine triphosphate analog containing a P-N-P linkage
 | périodique  = Biochemistry
 | volume      = 10
 | numéro      = 13
 | jour        = 
 | mois        = juin
 | année       = 1971
 | pages       = 2484–2489
 | url texte   = http://pubs.acs.org/doi/abs/10.1021/bi00789a009
 | consulté le = 31 mars 2014
 | doi         = 10.1021/bi00789a009
 | pmid        = 4326768
 | pmc         = 
}}</ref>. Il est utilisé depuis les années 1970 notamment pour étudier les interactions entre l'ATP et les [[enzyme]]s qui hydrolysent cette molécule ([[kinase]]s)<ref name="10.1016/0005-2744(74)90267-8">
{{Article
 | langue      = en
 | nom1        = Michael E. Maguire et Alfred G. Gilman
 | titre       = Adenylate cyclase assay with adenylyl imidodiphosphate and product detection by competitive protein binding
 | périodique  = Biochimica et Biophysica Acta (BBA) - Enzymology
 | volume      = 358
 | numéro      = 1
 | jour        = 17
 | mois        = juillet
 | année       = 1974
 | pages       = 154-163
 | url texte   = http://www.sciencedirect.com/science/article/pii/0005274474902678
 | consulté le = 31 mars 2014
 | doi         = 10.1016/0005-2744(74)90267-8
 | pmid        = 4368377
 | pmc         = 
}}</ref>, dont il est un [[inhibiteur enzymatique]]<ref name="PMID 4376952">
{{Article
 | langue      = en
 | nom1        = Roger D. Philo et Michael J. Selwyn
 | titre       = Inhibition of the soluble adenosine triphosphatase from mitochondria by adenylyl imidodiphosphate
 | périodique  = Biochemical Journal
 | volume      = 143
 | numéro      = 3
 | jour        = 
 | mois        = décembre
 | année       = 1974
 | pages       = 745-749
 | url texte   = http://www.biochemj.org/bj/143/bj1430745.htm
 | consulté le = 31 mars 2014
 | doi         = 
 | pmid        = 4376952
 | pmc         = 1168443
}}</ref>{{,}}<ref name="10.1016/0003-9861(75)90373-2">
{{Article
 | langue      = en
 | nom1        = Ronald L. Melnick, Joaquim Tavares De Sousa, John Maguire et Lester Packer
 | titre       = Action of the adenosine triphosphate analog, adenylyl imidodiphosphate in mitochondria
 | périodique  = Archives of Biochemistry and Biophysics
 | volume      = 166
 | numéro      = 1
 | jour        = 
 | mois        = janvier
 | année       = 1975
 | pages       = 139-144
 | url texte   = http://www.sciencedirect.com/science/article/pii/0003986175903732
 | consulté le = 31 mars 2014
 | doi         = 10.1016/0003-9861(75)90373-2
 | pmid        = 123727
 | pmc         = 
}}</ref>{{,}}<ref name="PMID 2557438">
{{Article
 | langue      = en
 | nom1        = M. Paulais et J. Teulon
 | titre       = A cation channel in the thick ascending limb of Henle's loop of the mouse kidney: inhibition by adenine nucleotides
 | périodique  = The Journal of Physiology
 | volume      = 413
 | numéro      = 
 | jour        = 1
 | mois        = juin
 | année       = 1989
 | pages       = 315-327
 | url texte   = http://jp.physoc.org/content/413/1/315.short
 | consulté le = 31 mars 2014
 | doi         = 
 | pmid        = 2557438
 | pmc         = 
}}</ref>.

== Notes et références ==

{{Références}}

{{Portail|chimie|biochimie}}

[[Catégorie:Adénine]]
[[Catégorie:Ribonucléotide]]