Voir la source de Chlorure de trans-dichlorobis(éthylènediamine)cobalt(III)

{{DISPLAYTITLE:Chlorure de ''trans''-dichlorobis(éthylènediamine)cobalt({{III}})}}
{{Infobox Chimie
 | nom = Chlorure de ''trans''-dichlorobis-<br>(éthylènediamine)cobalt({{III}})
 | image = Trans-dichlorobis(ethylendiamin)cobalt(III)-chlorid.png
 | taille image = 225
 | alternative =
 | image2 = 
 | taille image2 = 200
 | alternative2 =
 | images = <!--[[Fichier:|130px]][[Fichier:|130px]]<br>-->
 | légende = Structure du chlorure de ''trans''-dichlorobis(éthylènediamine)cobalt({{III}})
<!-- Général -->
 | DCI = 
 | nomIUPAC = 
 | nomSystematique = 
 | synonymes = 
 | CAS = {{CAS|1|4|0|4|0|3|3|6}}
 | ECHA = 
 | EINECS = {{EINECS|}}
 | RTECS = {{RTECS|}}
 | ATC = {{ATC|}} {{ATCvet|}}
 | DrugBank = 
 | PubChem = {{CID|12127156}}{{SID|}}
 | chEBI = 
 | NrE = {{NrE|}}
 | FEMA = {{FEMA|}}
 | SMILES = C(C[NH-])[NH-].C(C[NH-])[NH-].Cl[Co]Cl
 | InChI = 
 | InChIKey = 
 | StdInChI = 1S/2C2H6N2.2ClH.Co/c2*3-1-2-4;;;/h2*3-4H,1-2H2;2*1H;/q2*-2;;;+2/p-2
 | StdInChIKey = LBGRXLRZGLIOLI-UHFFFAOYSA-L
 | apparence = solide [[cristal]]lisé vert foncé d'aspect brillant<ref name="10.1002/9780470132333.ch71">
{{Article
 | langue      = en
 | nom1        = John C. Bailar Jr. et Carl L. Rollinson
 | titre       = ''cis''- and ''trans''-Dichlorobis–(ethylenediamine)cobalt(III) Chloride and the Resolution of the ''cis'' Form
 | périodique  = Inorganic Syntheses
 | volume      = 2
 | année       = 1946
 | pages       = 222-225
 | url texte   = https://onlinelibrary.wiley.com/doi/10.1002/9780470132333.ch71
 | consulté le = 17 juillet 2022
 | doi         = 10.1002/9780470132333.ch71
 }}</ref>
<!-- Propriétés chimiques -->
 | formule = |C=4|H=16|Cl=3|Co=1|N=4   <!--|cacher=oui|exp=|categorisationAuto=désactivée-->
 | masseMol = 
 | pKa = {{pKa||T(°C)=|T(K)=}}
 | momentDipolaire = {{unité/2||D}}
 | susceptibiliteMagnetique = 
 | diametreMoleculaire = {{unité/2||nm}}
 | indiceIode = 
 | indiceAcide = 
 | indiceSaponification = 
<!-- Propriétés physiques -->
 | TTransitionVitreuse = {{tmp||°C}}
 | fusion = {{tmp|237|239|°C}}<ref name="sa">
{{Lien web
 | langue      = en
 | format      = pdf
 | url         = https://www.sigmaaldrich.com/ZA/en/sds/aldrich/575909
 | titre       = ''trans''-Dichlorobis(ethylenediamine)cobalt(III) chloride
 | date        = 17 septembre 2019
 | site        = sigmaaldrich.com
 | éditeur     = [[Sigma-Aldrich]]
 | consulté le = 17 juillet 2022
}}.</ref> ([[Thermolyse (chimie)|décomposition]])
 | ebullition = {{tmp||°C}}
 | solubilite = {{Unité/2||g||L|-1}}
 | parametreSolubilite = <!-- {{Unité/2||MPa|1/2}} ({{température||°C}}) -->
 | miscibilite = 
 | masseVolumique = {{Unité/2||g||cm|-3}}
 | TAutoInflammation = {{tmp||°C}}
 | pointEclair = {{tmp||°C}}
 | limitesExplosivite = 
 | pressionVapeur = 
 | viscosite = 
 | pointCritique = 
 | pointTriple = 
 | conductivitéThermique = {{Unité/2||W||m|-1|K|-1}}
 | conductivitéÉlectrique = 
 | vitesseSon = {{Unité/2||m||s|-1}}
<!-- Thermochimie -->
 | emsGaz = {{Unité/2||J||K|-1|mol|-1}}
 | emsLiquide = {{Unité/2||J||K|-1|mol|-1}}
 | emsSolide = {{Unité/2||J||K|-1|mol|-1}}
 | esfGaz = {{Unité/2||kJ||mol|-1}}
 | esfLiquide = {{Unité/2||kJ||mol|-1}}
 | esfSolide = {{Unité/2||kJ||mol|-1}}
 | enthFus = 
 | enthVap = 
 | capaciteTherm = {{Unité/2||J||K|-1|mol|-1}}
 | PCS = 
 | PCI = 
<!-- Propriétés biochimiques -->
 | codons = 
 | pHisoelectrique = 
 | acideAmineEss = 
<!-- Propriétés électroniques -->
 | bandeInterdite = 
 | mobiliteElectronique = 
 | mobiliteTrous = 
 | 1reEnergieIonisation = 
 | constanteDielectrique = 
<!-- Cristallographie -->
 | systemeCristallin = 
 | reseauBravais = 
 | Pearson = {{SymbolePearson|}}
 | classe = <!-- '' ''{{surligner|}}'' ''  ({{n°}})--> {{Infobox Chimie/Groupe espace||ref=}}
 | Schoenflies = 
 | Strukturbericht = 
 | structureType = 
 | parametresMaille = 
 | volume = 
 | macle = 
<!-- Propriétés optiques -->
 | refraction = <!--<math>\textit{n}_{D}^{20}</math> = --> <!-- {{réfraction|T=|λ=|k=|}} -->
 | birefringence = 
 | dispersion = 
 | polychroisme = 
 | fluorescence = <!-- λ<sub>excitation</sub> {{λ||nm}} ; <br>λ<sub>émission</sub> {{λ||nm}} -->
 | absorption = 
 | transparence = 
 | pvrRotatoire = <!-- <math>\lbrack\alpha\rbrack_{D}^{25} = </math> -->
 | cteVerdet = 
<!-- Précautions -->
 | radioactif = 
 | numeroIndex = {{indexCE|}}
 | SGHref = <ref name="sa"/>
 | SGH = {{SGH|SGH07|Wng|H315|H319|H335|P261|P305+P351+P338}}
 | SIMDUTref = 
 | SIMDUT = {{SIMDUT|}}
 | NFPA704ref = 
 | NFPA704 = {{NFPA 704|Health=|Flammability=|Reactivity=|Other=}}
 | transportRef = 
 | transport = {{ADR|Kemler=|ONU=|Classe=|CodeClassification=|Etiquette=|Etiquette2=|Etiquette3=|Emballage=}}
 | CIRC = 
 | inhalation = 
 | peau = 
 | yeux = 
 | ingestion = 
<!-- Écotoxicologie -->
 | DL50 = <!-- {{Unité/2||mg||kg|-1}} (souris, [[Ingestion|oral]]) <br> (souris, [[Injection intraveineuse|i.v.]]) <br> (souris, [[sous-cutané|s.c.]]) <br> (souris, [[intrapéritonéal|i.p.]]) -->
 | CL50 = 
 | LogP = <!--([[octanol]]/eau)-->
 | DJA = 
 | ARFD =  <!--mg/kg pc-->
 | AOEL = <!--mg/kg par jour-->
 | odorat = 
<!-- Données pharmacocinétiques -->
 | CAM = 
 | biodisponibilite = 
 | liaisonProteique = 
 | metabolisme = 
 | demiVieDistrib = 
 | demiVieElim = 
 | stockage = 
 | excretion = 
<!-- Considérations thérapeutiques -->
 | classeTherapeutique = 
 | voieAdministration = 
 | grossesse = 
 | conduiteAuto = 
 | precautions = 
 | antidote = 
<!-- Caractère psychotrope -->
 | categoriePsycho = 
 | modeConsommation = 
 | autresNoms = 
 | risqueDependance = 
<!-- Composés apparentés -->
 | autres = 
 | autrescations = 
 | autresanions = 
 | isomères = 
<!-- Supplément -->
 | supplement = 
}}<!-- ----------------------------- Fin de l'infoboîte ----------------------------- -->
Le '''chlorure de ''trans''-dichlorobis(éthylènediamine)cobalt({{III}})''' est un [[Sel (chimie)|sel]] de [[formule chimique]] {{nobr|[{{fchim|CoCl|2|([[Éthylènediamine|en]])|2}}]Cl}}, où « en » est la notation habituelle pour le [[Ligand (chimie)|ligand]] [[Denticité|bidenté]] [[éthylènediamine]] {{fchim|NH|2|CH|2|CH|2|NH|2}}. Il s'agit d'un solide [[cristal]]lisé [[Diamagnétisme|diamagnétique]] vert foncé facilement soluble dans l'eau. L'un des [[ion]]s [[chlorure]] est [[Labilité|labile]] et peut facilement être échangé, en revanche les deux autres sont liés au centre [[métal]]lique et sont moins réactifs. Outre l'[[Isomérie|isomère]] ''trans'', on connaît également le [[Chlorure de cis-dichlorobis(éthylènediamine)cobalt(III)|{{nobr|''cis''-[{{fchim|CoCl|2|(en)|2}}]Cl}}]].

<gallery mode="packed" heights="180px">
Fichier:Trans dichloribis(ethylenediamine)cobalt(III) chloride.jpg|{{Centrer|Cristaux de {{nobr|''trans''-[{{fchim|CoCl|2|(en)|2}}]Cl}}.}}
Fichier:Ultraviolet-visible spectroscopy of Dichlorobis(ethylenediamine)cobalt(III) chloride.png|{{Centrer|[[Spectroscopie ultraviolet-visible|Spectroscopie UV-visible]] de l'[[isomérisation]] ''trans'' ⟶ ''[[Chlorure de cis-dichlorobis(éthylènediamine)cobalt(III)|cis]]'' (ce dernier en rouge).}}
</gallery>

== Synthèse ==

Il peut être obtenu par réaction d'éthylènediamine avec du [[chlorure de cobalt(II)]] {{fchim|CoCl|2}} dans un flux d'air puis réaction avec de l'[[acide chlorhydrique]] concentré<ref name="10.1002/9780470132333.ch71"/>:
:[[Chlorure de cobalt(II)|{{fchim|CoCl|2}}]] + 2 [[Éthylènediamine|{{fchim|NH|2|CH|2|CH|2|NH|2}}]] + [[Acide chlorhydrique|HCl]] + {{frac|4}} [[Dioxygène|{{fchim|O|2}}]] ⟶ {{nobr|''trans''-[{{fchim|CoCl|2|(NH|2|CH|2|CH|2|NH|2|)|2}}]Cl}} + {{frac|2}} [[Eau|{{fchim|H|2|O}}]].

L'acide chlorhydrique résiduel est évaporé de la solution par chauffage. Il est également possible d'obtenir ce produit en faisant réagir du [[chlorure de carbonatobis(éthylènediamine)cobalt(III)]] {{nobr|[{{fchim|CoCO|3|([[Éthylènediamine|en]])|2}}]Cl}} avec de l'acide chlorhydrique<ref name="10.1002/9780470132456.ch14">
{{Article
 | langue      = en
 | nom1        = J. Springbørg, C. E. Schäffer, John M. Preston et Bodie Douglas
 | titre       = Dianionobis(ethylenediamine)cobalt(III) Complexes
 | périodique  = Inorganic Syntheses
 | volume      = 14
 | année       = 1973
 | pages       = 63-77
 | url texte   = https://onlinelibrary.wiley.com/doi/10.1002/9780470132456.ch14
 | consulté le = 17 juillet 2022
 | doi         = 10.1002/9780470132456.ch14
 }}</ref> :
:[[Chlorure de carbonatobis(éthylènediamine)cobalt(III)|{{nobr|[{{fchim|CoCO|3|(en)|2}}]Cl}}]] + 2 [[Acide chlorhydrique|HCl]] ⟶ {{nobr|''trans''-[{{fchim|CoCl|2|([[Éthylènediamine|en]])|2}}]Cl}} + [[Dioxyde de carbone|{{fchim|CO|2}}]] + [[Eau|{{fchim|H|2|O}}]].

== Propriétés ==

Les cristaux de chlorure de ''trans''-dichlorobis(éthylènediamine)cobalt({{III}}) restent stables dans l'air à température ambiante. En [[solution aqueuse]], l'[[Isomérie|isomère]] ''trans'', de couleur verte, est en [[Équilibre chimique|équilibre]] avec l'isomère ''cis'', moins soluble, de couleur violette ; à {{tmp|23.0|°C}}, la [[constante d'équilibre]] vaut<ref name="10.1007/BF02165334">
{{Article
 | langue      = en
 | nom1        = D. T. Haworth, E. F. Neuzil et S. L. Kittsley 
 | titre       = Thermodynamics of the ''cis''-''trans'' interconversion of dichlorobis-(ethylenediamine)-cobalt(III) chloride
 | périodique  = Experientia
 | volume      = 12
 | numéro      = 9
 | mois        = septembre
 | année       = 1956
 | pages       = 335
 | url texte   = https://link.springer.com/article/10.1007/BF02165334
 | consulté le = 17 juillet 2022
 | doi         = 10.1007/BF02165334
 }}</ref>{{,}}<ref>
{{Article
 | langue      = en
 | nom1        = Robert C. Brasted et Chikara Hirayama
 | titre       = The ''cis''-''trans'' Isomerization of Dichlorobis-(ethylenediamine)-cobalt(III) Chloride and Dichlorobis-(propylenediamine)-cobalt(III) Chloride in Alcohols
 | périodique  = Journal of the American Chemical Society
 | volume      = 80
 | numéro      = 4
 | mois        = février
 | année       = 1958
 | pages       = 788-794
 | url texte   = https://pubs.acs.org/doi/abs/10.1021/ja01537a009
 | consulté le = 17 juillet 2022
 | doi         = 10.1021/ja01537a009
 }}</ref> :
:''K'' = {{sfrac|[[Chlorure de cis-dichlorobis(éthylènediamine)cobalt(III)|{{nobr|''cis''-[{{fchim|CoCl|2|(en)|2}}]Cl}}]]|{{nobr|''trans''-[{{fchim|CoCl|2|(en)|2}}]Cl}}}} = 11,60.

Le [[cation]] {{nobr|''trans''-[{{fchim|CoCl|2|(en)|2}}]{{exp|+}}}} a une [[géométrie moléculaire]] idéalisée {{nobr|''D''{{ind|2h}}}} tandis que l'isomère {{nobr|''cis''-[{{fchim|CoCl|2|(en)|2}}]{{exp|+}}}} a une symétrie {{nobr|''C''{{ind|2}}}}.

<gallery mode="packed" heights="120px">
Fichier:Cis-Dichlorobis(ethylenediamine)cobalt(III) chloride.png|{{Centrer|{{nobr|[[Chlorure de cis-dichlorobis(éthylènediamine)cobalt(III)|{{nobr|''cis''-[{{fchim|CoCl|2|(en)|2}}]Cl}}]].}}}}
Fichier:Trans-dichlorobis(ethylendiamin)cobalt(III)-chlorid.png|{{Centrer|{{nobr|''trans''-[{{fchim|CoCl|2|(en)|2}}]Cl}}.}}
</gallery>

Le chauffage des cristaux jusqu'à leur [[point de fusion]] donne une sorte de résine élastique qui se décompose en solution en ses constituants ; le [[Chlorure de cobalt(II)|{{fchim|CoCl|2}}]] donne à la substance une coloration brune à rougeâtre.

== Notes et références ==
{{Références}}

{{Portail|chimie}}

[[Catégorie:Complexe d'éthylènediamine|Cobalt]]
[[Catégorie:Chlorure]]
[[Catégorie:Sel]]