Voir la source de FGI-103

{{Infobox Chimie
 | nom = FGI-103
 | image = FGI-103.svg
 | image2 = 
 | taille image = 260
 | légende = Structure du FGI-103
<!-- Général -->
 | DCI = 
 | nomIUPAC = 2-[(E)-2-(5-carbamimidoyl-1-benzofuran-2-yl)éthényl]-3H-benzimidazole-5-carboximidamide
 | synonymes = 
 | CAS = {{CAS|9|0|7|1|6|9|6|9|1}}
 | EINECS = {{EINECS|}}
 | RTECS = {{RTECS|}}
 | ATC = {{ATC|}} {{ATCvet|}}
 | DrugBank = 
 | PubChem = {{CID|5477931}}{{SID|}}
 | chEBI = 
 | NrE = {{NrE|}}
 | FEMA = {{FEMA|}}
 | SMILES = C1=CC2=C(C=C1C(=N)N)NC(=N2)/C=C/C3=CC4=C(O3)C=CC(=C4)C(=N)N
 | InChI = 
 | InChIKey = 
 | StdInChI = 1S/C19H16N6O/c20-18(21)10-2-5-16-12(7-10)8-13(26-16)3-6-17-24-14-4-1-11(19(22)23)9-15(14)25-17/h1-9H,(H3,20,21)(H3,22,23)(H,24,25)/b6-3+
 | StdInChIKey = OOKWWPFCCCMWIS-ZZXKWVIFSA-N
 | apparence = 
<!-- Propriétés chimiques -->
 | formule = |C=19|H=16|N=6|O=1
 | masseMol = 
 | pKa = {{pKa||T(°C)=|T(K)=}}
 | momentDipolaire = {{unité/2||D}}
 | susceptibiliteMagnetique = 
 | diametreMoleculaire = {{unité/2||nm}}
 | indiceIode = 
 | indiceAcide = 
 | indiceSaponification = 
<!-- Propriétés physiques -->
 | TTransitionVitreuse = {{tmp||°C}}
 | fusion = {{tmp||°C}}
 | ebullition = {{tmp||°C}}
 | solubilite = {{Unité/2||g||L|-1}}
 | parametreSolubilite = <!-- {{Unité/2||MPa|1/2}} ({{température||°C}}) -->
 | miscibilite = 
 | masseVolumique = {{Unité/2||g||cm|-3}}
 | TAutoInflammation = {{tmp||°C}}
 | pointEclair = {{tmp||°C}}
 | limitesExplosivite = 
 | pressionVapeur = 
 | viscosite = 
 | pointCritique = 
 | pointTriple = 
 | conductivitéThermique = {{Unité/2||W||m|-1|K|-1}}
 | conductivitéÉlectrique = 
 | vitesseSon = {{Unité/2||m||s|-1}}
<!-- Thermochimie -->
 | emsGaz = {{Unité/2||J||K|-1|mol|-1}}
 | emsLiquide = {{Unité/2||J||K|-1|mol|-1}}
 | emsSolide = {{Unité/2||J||K|-1|mol|-1}}
 | esfGaz = {{Unité/2||kJ||mol|-1}}
 | esfLiquide = {{Unité/2||kJ||mol|-1}}
 | esfSolide = {{Unité/2||kJ||mol|-1}}
 | enthFus = 
 | enthVap = 
 | capaciteTherm = {{Unité/2||J||K|-1|mol|-1}}
 | PCS = 
 | PCI = 
<!-- Propriétés biochimiques -->
 | codons = 
 | pHisoelectrique = 
 | acideAmineEss = 
<!-- Propriétés électroniques -->
 | bandeInterdite = 
 | mobiliteElectronique = 
 | mobiliteTrous = 
 | 1reEnergieIonisation = 
 | constanteDielectrique = 
<!-- Cristallographie -->
 | systemeCristallin = 
 | reseauBravais = 
 | Pearson = {{SymbolePearson|}}
 | classe = {{Infobox Chimie/Groupe espace||ref=}}
 | Schoenflies = 
 | Strukturbericht = 
 | structureType = 
 | parametresMaille = 
 | volume = 
 | macle = 
<!-- Propriétés optiques -->
 | refraction = {{réfraction|T=|λ=|}}
 | birefringence = 
 | dispersion = 
 | polychroisme = 
 | fluorescence = <!-- λ<sub>excitation</sub> {{λ||nm}} ; <br />λ<sub>émission</sub> {{λ||nm}} -->
 | absorption = 
 | transparence = 
 | pvrRotatoire = <!-- <math>\lbrack\alpha\rbrack_{D}^{25}</math> -->
 | cteVerdet = 
<!-- Précautions -->
 | radioactif = 
 | 67548EEC = 
 | 67548EECref = 
 | symboles = 
 | numeroIndex = {{indexCE|}}
 | classificationCE = 
 | r = 
 | s = 
 | transportRef = 
 | transport = {{ADR|Kemler=|ONU=|Classe=|CodeClassification=|Etiquette=|Etiquette2=|Etiquette3=|Emballage=}}
 | NFPA704ref = 
 | NFPA704 = {{NFPA 704|Health=|Flammability=|Reactivity=|Other=}}
 | SIMDUTref = 
 | SIMDUT = {{SIMDUT|}}
 | SGHref = 
 | SGH = {{SGH|}}
 | CIRC = 
 | inhalation = 
 | peau = 
 | yeux = 
 | ingestion = 
<!-- Écotoxicologie -->
 | DL50 = <!-- {{Unité/2||mg||kg|-1}} (souris, [[Ingestion|oral]]) <br /> (souris, [[Injection intraveineuse|i.v.]]) <br /> (souris, [[sous-cutané|s.c.]]) <br /> (souris, [[intrapéritonéal|i.p.]]) -->
 | CL50 = 
 | LogP = 
 | DJA = 
 | odorat = 
<!-- Données pharmacocinétiques -->
 | CAM = 
 | biodisponibilite = 
 | liaisonProteique = 
 | metabolisme = 
 | demiVieDistrib = 
 | demiVieElim = 
 | stockage = 
 | excretion = 
<!-- Considérations thérapeutiques -->
 | classeTherapeutique = 
 | voieAdministration = 
 | grossesse = 
 | conduiteAuto = 
 | precautions = 
 | antidote = 
<!-- Caractère psychotrope -->
 | categoriePsycho = 
 | modeConsommation = 
 | autresNoms = 
 | risqueDependance = 
<!-- Composés apparentés -->
 | autres = 
 | autrescations = 
 | autresanions = 
 | isomères = 
<!-- Supplément -->
 | supplement = 
}}<!-- ----------------------------- Fin de l'infoboîte ----------------------------- -->
Le '''FGI-103''' est un [[médicament]] [[antiviral]] expérimental développé comme traitement potentiel contre la [[maladie à virus Ebola]] et celle à [[virus Marburg]]. Il s'est montré efficace contre ces deux virus lorsqu'il était administré à des [[souris]] jusqu'à {{nobr|48 h}} après l'exposition aux virus. Le mécanisme d'action de cette molécule n'a pas été élucidé, mais il est apparu qu'elle n'agit pas selon les mécanismes habituellement employés par les antiviraux semblables<ref name="10.1128/AAC.01315-09">
{{Article
 | langue      = en
 | nom1        = Travis K. Warren, Kelly L. Warfield, Jay Wells, Sven Enterlein, Mark Smith, Gordon Ruthel, Abdul S. Yunus, Michael S. Kinch, Michael Goldblatt, M. Javad Aman et Sina Bavari
 | titre       = Antiviral Activity of a Small-Molecule Inhibitor of Filovirus Infection
 | périodique  = Antimicrobial Agents and Chemotherapy
 | volume      = 54
 | numéro      = 5
 | jour        = 
 | mois        = mai
 | année       = 2010
 | pages       = 2152-2159
 | url texte   = http://aac.asm.org/content/54/5/2152
 | consulté le = 14 janvier 2015
 | doi         = 10.1128/AAC.01315-09
 | pmid        = 
 | pmc         = 
}}</ref>{{,}}<ref name="10.3390/v4091477">
{{Article
 | langue      = en
 | nom1        = Steven B. Bradfute, Kelly L. Warfield et Mike Bray
 | titre       = Mouse Models for Filovirus Infections
 | périodique  = Viruses
 | volume      = 4
 | numéro      = 9
 | jour        = 7
 | mois        = septembre
 | année       = 2012
 | pages       = 1477-1508
 | url texte   = http://www.mdpi.com/1999-4915/4/9/1477
 | consulté le = 14 janvier 2015
 | doi         = 10.3390/v4091477
 | pmid        = 
 | pmc         = 
}}</ref>.

== Notes et références ==

{{Références}}

{{Palette|Traitements contre Ebola}}

{{Portail|chimie|pharmacie}}

[[Catégorie:Antiviral]]
[[Catégorie:Benzofurane]]
[[Catégorie:Benzimidazole]]
[[Catégorie:Amidine]]