Voir la source de LJ-001

{{Infobox Chimie
 | nom = LJ-001
 | image = LJ-001.svg
 | image2 = 
 | taille image = 260
 | légende = Structure du LJ-001
<!-- Général -->
 | DCI = 
 | nomIUPAC = (5Z)-5-[(5-phénylfuran-2-yl)méthylidène]-3-prop-2-ényl-2-sulfanylidène-1,3-thiazolidin-4-one
 | synonymes = 
 | CAS = {{CAS|}}
 | EINECS = {{EINECS|}}
 | RTECS = {{RTECS|}}
 | ATC = {{ATC|}} {{ATCvet|}}
 | DrugBank = 
 | PubChem = {{CID|2272467}}{{SID|}}
 | chEBI = 
 | NrE = {{NrE|}}
 | FEMA = {{FEMA|}}
 | SMILES = C=CCN1C(=O)/C(=C/C2=CC=C(O2)C3=CC=CC=C3)/SC1=S
 | InChI = 
 | InChIKey = 
 | StdInChI = 1S/C17H13NO2S2/c1-2-10-18-16(19)15(22-17(18)21)11-13-8-9-14(20-13)12-6-4-3-5-7-12/h2-9,11H,1,10H2/b15-11-
 | StdInChIKey = YAIFLEPRFXXIFQ-PTNGSMBKSA-N
 | apparence = 
<!-- Propriétés chimiques -->
 | formule = |C=17|H=13|N=1|O=2|S=2
 | masseMol = 
 | pKa = {{pKa||T(°C)=|T(K)=}}
 | momentDipolaire = {{unité/2||D}}
 | susceptibiliteMagnetique = 
 | diametreMoleculaire = {{unité/2||nm}}
 | indiceIode = 
 | indiceAcide = 
 | indiceSaponification = 
<!-- Propriétés physiques -->
 | TTransitionVitreuse = {{tmp||°C}}
 | fusion = {{tmp||°C}}
 | ebullition = {{tmp||°C}}
 | solubilite = {{Unité/2||g||L|-1}}
 | parametreSolubilite = <!-- {{Unité/2||MPa|1/2}} ({{température||°C}}) -->
 | miscibilite = 
 | masseVolumique = {{Unité/2||g||cm|-3}}
 | TAutoInflammation = {{tmp||°C}}
 | pointEclair = {{tmp||°C}}
 | limitesExplosivite = 
 | pressionVapeur = 
 | viscosite = 
 | pointCritique = 
 | pointTriple = 
 | conductivitéThermique = {{Unité/2||W||m|-1|K|-1}}
 | conductivitéÉlectrique = 
 | vitesseSon = {{Unité/2||m||s|-1}}
<!-- Thermochimie -->
 | emsGaz = {{Unité/2||J||K|-1|mol|-1}}
 | emsLiquide = {{Unité/2||J||K|-1|mol|-1}}
 | emsSolide = {{Unité/2||J||K|-1|mol|-1}}
 | esfGaz = {{Unité/2||kJ||mol|-1}}
 | esfLiquide = {{Unité/2||kJ||mol|-1}}
 | esfSolide = {{Unité/2||kJ||mol|-1}}
 | enthFus = 
 | enthVap = 
 | capaciteTherm = {{Unité/2||J||K|-1|mol|-1}}
 | PCS = 
 | PCI = 
<!-- Propriétés biochimiques -->
 | codons = 
 | pHisoelectrique = 
 | acideAmineEss = 
<!-- Propriétés électroniques -->
 | bandeInterdite = 
 | mobiliteElectronique = 
 | mobiliteTrous = 
 | 1reEnergieIonisation = 
 | constanteDielectrique = 
<!-- Cristallographie -->
 | systemeCristallin = 
 | reseauBravais = 
 | Pearson = {{SymbolePearson|}}
 | classe = {{Infobox Chimie/Groupe espace||ref=}}
 | Schoenflies = 
 | Strukturbericht = 
 | structureType = 
 | parametresMaille = 
 | volume = 
 | macle = 
<!-- Propriétés optiques -->
 | refraction = {{réfraction|T=|λ=|}}
 | birefringence = 
 | dispersion = 
 | polychroisme = 
 | fluorescence = <!-- λ<sub>excitation</sub> {{λ||nm}} ; <br />λ<sub>émission</sub> {{λ||nm}} -->
 | absorption = 
 | transparence = 
 | pvrRotatoire = <!-- <math>\lbrack\alpha\rbrack_{D}^{25}</math> -->
 | cteVerdet = 
<!-- Précautions -->
 | radioactif = 
 | 67548EEC = 
 | 67548EECref = 
 | symboles = 
 | numeroIndex = {{indexCE|}}
 | classificationCE = 
 | r = 
 | s = 
 | transportRef = 
 | transport = {{ADR|Kemler=|ONU=|Classe=|CodeClassification=|Etiquette=|Etiquette2=|Etiquette3=|Emballage=}}
 | NFPA704ref = 
 | NFPA704 = {{NFPA 704|Health=|Flammability=|Reactivity=|Other=}}
 | SIMDUTref = 
 | SIMDUT = {{SIMDUT|}}
 | SGHref = 
 | SGH = {{SGH|}}
 | CIRC = 
 | inhalation = 
 | peau = 
 | yeux = 
 | ingestion = 
<!-- Écotoxicologie -->
 | DL50 = <!-- {{Unité/2||mg||kg|-1}} (souris, [[Ingestion|oral]]) <br /> (souris, [[Injection intraveineuse|i.v.]]) <br /> (souris, [[sous-cutané|s.c.]]) <br /> (souris, [[intrapéritonéal|i.p.]]) -->
 | CL50 = 
 | LogP = 
 | DJA = 
 | odorat = 
<!-- Données pharmacocinétiques -->
 | CAM = 
 | biodisponibilite = 
 | liaisonProteique = 
 | metabolisme = 
 | demiVieDistrib = 
 | demiVieElim = 
 | stockage = 
 | excretion = 
<!-- Considérations thérapeutiques -->
 | classeTherapeutique = 
 | voieAdministration = 
 | grossesse = 
 | conduiteAuto = 
 | precautions = 
 | antidote = 
<!-- Caractère psychotrope -->
 | categoriePsycho = 
 | modeConsommation = 
 | autresNoms = 
 | risqueDependance = 
<!-- Composés apparentés -->
 | autres = 
 | autrescations = 
 | autresanions = 
 | isomères = 
<!-- Supplément -->
 | supplement = 
}}<!-- ----------------------------- Fin de l'infoboîte ----------------------------- -->
Le '''LJ-001''' est un [[médicament]] [[antiviral]] expérimental à spectre large développé comme traitement potentiel contre les [[virus]] à [[Enveloppe virale|enveloppe]]. Il agit en empêchant la pénétration du virus dans la [[Cellule (biologie)|cellule]], après que le virus s'est attaché à la cellule cible mais avant sa fusion avec cette dernière. Il inactive également les [[virion]]s eux-mêmes en générant des [[molécule]]s d'[[oxygène singulet]] qui endommagent l'enveloppe virale. Testée sur des [[Culture cellulaire|cultures cellulaires]] ''[[in vitro]]'', cette molécule s'est montrée capable de bloquer et d'inactiver une grande variété de virus, notamment les [[virus de la grippe A]], les [[Filoviridae|filovirus]], les [[Poxviridae|poxvirus]], les [[Arenavirus|arénavirus]], les [[Bunyaviridae|bunyavirus]], les [[Paramyxoviridae|paramyxovirus]], les [[flavivirus]] et le [[Virus de l'immunodéficience humaine|VIH]]<ref name="10.1073/pnas.0909587107">
{{Article
 | langue      = en
 | nom1        = Mike C. Wolf, Alexander N. Freiberg, Tinghu Zhang, Zeynep Akyol-Ataman, Andrew Grock, Patrick W. Hong, Jianrong Li, Natalya F. Watson, Angela Q. Fang, Hector C. Aguilar, Matteo Porotto, Anna N. Honko, Robert Damoiseaux, John P. Miller, Sara E. Woodson, Steven Chantasirivisal, Vanessa Fontanes, Oscar A. Negrete, Paul Krogstad, Asim Dasgupta, Anne Moscona, Lisa E. Hensley, Sean P. Whelan, Kym F. Faull, Michael R. Holbrook, Michael E. Jung et Benhur Lee
 | titre       = A broad-spectrum antiviral targeting entry of enveloped viruses
 | périodique  = Proceedings of the National Academy of Sciences of the United States of America
 | volume      = 107
 | numéro      = 7
 | jour        = 16
 | mois        = février
 | année       = 2010
 | pages       = 3157-3162
 | url texte   = http://www.pnas.org/content/107/7/3157
 | consulté le = 14 janvier 2015
 | doi         = 10.1073/pnas.0909587107
 | pmid        = 20133606
 | pmc         = 2840368
}}</ref>.

Le LJ-001 lui-même est cependant impropre à une utilisation thérapeutique en raison de son manque de stabilité physiologique et du fait que son activité antivirale requiert de la lumière<ref>
{{en}} [http://defectivebrain.fieldofscience.com/2013/08/microtwjc-part-2-rise-and-fall-of-lj-001.html The Rise and Fall of LJ-001], {{nobr|19 août 2013}}.</ref>. Cependant, la découverte de ce nouveau mécanisme permettant de bloquer l'entrée du virus dans les cellules et d'inactiver les virions eux-mêmes a ouvert la voie au développement d'une nouvelle famille de médicaments aux propriétés améliorées<ref name="10.1371/journal.ppat.1003297">
{{Article
 | langue      = en
 | nom1        = Frederic Vigant, Jihye Lee, Axel Hollmann, Lukas B. Tanner, Zeynep Akyol Ataman, Tatyana Yun, Guanghou Shui, Hector C. Aguilar, Dong Zhang, David Meriwether, Gleyder Roman-Sosa, Lindsey R. Robinson, Terry L. Juelich, Hubert Buczkowski, Sunwen Chou, Miguel A. R. B. Castanho, Mike C. Wolf, Jennifer K. Smith, Ashley Banyard, Margaret Kielian, Srinivasa Reddy, Markus R. Wenk, Matthias Selke, Nuno C. Santos, Alexander N. Freiberg, Michael E. Jung, Benhur Lee
 | titre       = A Mechanistic Paradigm for Broad-Spectrum Antivirals that Target Virus-Cell Fusion
 | périodique  = PLoS Pathogens
 | volume      = 9
 | numéro      = 4
 | jour        = 18
 | mois        = avril
 | année       = 2013
 | pages       = e1003297
 | url texte   = http://www.plospathogens.org/article/fetchObject.action?uri=info:doi/10.1371/journal.ppat.1003297&representation=PDF
 | consulté le = 14 janvier 2015
 | doi         = 10.1371/journal.ppat.1003297
 | pmid        = 23637597
 | pmc         = 3630091
}}</ref>{{,}}<ref name="10.1042/BJ20131058">
{{Article
 | langue      = en
 | nom1        = Axel Hollmann, Miguel A. R. B. Castanho, Benhur Lee et Nuno C. Santos
 | titre       = Singlet oxygen effects on lipid membranes: implications for the mechanism of action of broad-spectrum viral fusion inhibitors
 | périodique  = Biochemical Journal
 | volume      = 459
 | numéro      = 1
 | jour        = 
 | mois        = avril
 | année       = 2014
 | pages       = 161-170
 | url texte   = http://www.biochemj.org/bj/459/bj4590161.htm
 | consulté le = 14 janvier 2015
 | doi         = 10.1042/BJ20131058
 | pmid        = 24456301
 | pmc         = 
}}</ref>.

== Notes et références ==

{{Références}}

{{Palette|Traitements contre Ebola}}

{{Portail|chimie|pharmacie}}

[[Catégorie:Antiviral]]
[[Catégorie:Furane]]
[[Catégorie:Thiazolidine]]
[[Catégorie:Composé phénylé]]
[[Catégorie:Composé allylique]]