Voir la source de Phénanthridine

{{Infobox Chimie
| nom = Phénanthridine
| image = Phenanthridin - Phenanthridine.svg
| image2 = 
| taille image = 200
| légende = 
<!-- Général -->
| DCI = 
| nomIUPAC = phénanthridine
| nomSystematique = 
| synonymes = benzo[c]quinoline<br />6-phénanthridine<br />3,4-benzoquinoline<br />9-azaphénanthrène
| CAS = {{CAS|229-87-8}}
| EINECS = {{EINECS|205-934-4}}
| RTECS = {{RTECS|}}
| ATC = {{ATC|}} {{ATCvet|}}
| DrugBank = 
| PubChem = {{CID|9189}}{{SID|}}
| chEBI = 
| NrE = {{NrE|}}
| FEMA = {{FEMA|}}
| SMILES = C1=CC=C2C(=C1)C=NC3=CC=CC=C23
| InChI = 1S/C13H9N/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13/h1-9H
| InChIKey = RDOWQLZANAYVLL-UHFFFAOYSA-N
| StdInChI = 
| StdInChIKey =
| apparence = poudre cristalline blanche<ref name=S>{{Sigma-Aldrich|ALDRICH|262692|Phenanthridine|Date=18/01/2011}}</ref>
<!-- Propriétés chimiques -->
| formule = |C=13|H=9|N=1
| masseMol = 
| pKa = {{pKa||T(°C)=|T(K)=}}
| momentDipolaire = {{unité/2||D}}
| susceptibiliteMagnetique = 
| diametreMoleculaire = {{unité/2||nm}}
| indiceIode = 
| indiceAcide = 
| indiceSaponification = 
<!-- Propriétés physiques -->
| TTransitionVitreuse = {{tmp||°C}}
| fusion = {{tmp|104-107|°C}}<ref name=S/>
| ebullition = {{tmp|660|°F}} à 760,0 [[mmHg]]<ref name=P>PubChem CID {{CID|9189}}</ref><br />{{tmp|349|°C}} à 1025 [[Pascal (unité)|hPa]]<ref name=S/>
| solubilite = {{Unité/2||g||l|-1}}
| masseVolumique = eau :{{Unité/2|7.7|µg||mL}}<ref name=P/>
| TAutoInflammation = {{tmp||°C}}
| pointEclair = {{tmp||°C}}
| limitesExplosivite = 
| pressionVapeur = 
| viscosite = 
| pointCritique = 
| pointTriple = 
| conductivitéThermique = {{Unité/2||W||m|-1|K|-1}}
| conductivitéÉlectrique = 
| vitesseSon = {{Unité/2||m||s|-1}}
<!-- Thermochimie -->
| emsGaz = {{Unité/2||J||K|-1|mol|-1}}
| emsLiquide = {{Unité/2||J||K|-1|mol|-1}}
| emsSolide = {{Unité/2||J||K|-1|mol|-1}}
| esfGaz = {{Unité/2||kJ||mol|-1}}
| esfLiquide = {{Unité/2||kJ||mol|-1}}
| esfSolide = {{Unité/2||kJ||mol|-1}}
| enthFus = 
| enthVap = 
| capaciteTherm = {{Unité/2||J||K|-1|mol|-1}}
| PCS = 
| PCI = 
<!-- Propriétés biochimiques -->
| codons = 
| pHisoelectrique = 
| acideAmineEss = 
<!-- Propriétés électroniques -->
| bandeInterdite = 
| mobiliteElectronique = 
| mobiliteTrous = 
| 1reEnergieIonisation = 
| constanteDielectrique = 
<!-- Cristallographie -->
| systemeCristallin = 
| reseauBravais = 
| Pearson = {{SymbolePearson|}}
| classe = <!-- '' ''{{surligner|}}'' ''  ({{n°}})-->
| Schoenflies = 
| Strukturbericht = 
| structureType = 
| parametresMaille = 
| volume = 
| macle = 
<!-- Propriétés optiques -->
| refraction = <!--<math>\textit{n}_{D}^{20}</math> = -->{{réfraction|T=|?=|}}
| birefringence = 
| dispersion = 
| polychroisme = 
| fluorescence = <!--<math>\lambda</math><sub>excitation</sub> {{?||nm}};<br /><math>\lambda</math><sub>émission</sub> {{?||nm}} -->
| absorption = 
| transparence = 
| pvrRotatoire = <!--<math>\lbrack\alpha\rbrack_{D}^{25}</math>-->
| cteVerdet = 
<!-- Précautions -->
| 67548EECref = <ref name=S/>
| symboles = Xn
| numeroIndex = {{indexCE|}}
| classificationCE = 
| r = R22, R37/38, R41
| s = S26, S39
| transportRef = <ref name=P/>
| transport = {{ADR|Kemler=|ONU=2811|Classe=|CodeClassification=|Etiquette=|Etiquette2=|Etiquette3=|Emballage=}}
| NFPA704ref = 
| NFPA704 = {{NFPA 704|Health=|Flammability=|Reactivity=|Other=}}
| SIMDUTref = 
| SIMDUT = {{SIMDUT|}}
| SGHref = <ref name=S/>
| SGH = {{SGH|SGH05|SGH06|H301|H315|H318|H335|P261|P280|P301+P310|P305+P351+P338}}
| CIRC = 
| inhalation = 
| peau = 
| yeux = 
| ingestion = 
<!-- Écotoxicologie -->
| DL50 = <!-- (souris, [[Ingestion|oral]]) <br /> (souris, [[Injection intraveineuse|i.v.]]) <br /> (souris, [[sous-cutané|s.c.]]) <br /> (souris, [[intrapéritonéal|i.p.]]) -->
| CL50 = 
| LogP = <!--([[octanol]]/eau)-->
| DJA = 
| odorat = 
<!-- Classe thérapeutique -->
| classeTherapeutique = 
<!-- Données pharmacocinétiques -->
| CAM = 
| biodisponibilite = 
| liaisonProteique = 
| metabolisme = 
| demiVieDistrib = 
| demiVieElim = 
| stockage = 
| excretion = 
<!-- Considérations thérapeutiques -->
| voieAdministration = 
| grossesse = 
| conduiteAuto = 
| precautions = 
| antidote = 
<!-- Caractère psychotrope -->
| categoriePsycho = 
| modeConsommation = 
| autresNoms = 
| risqueDependance = 
<!-- Composés apparentés -->
| autres = 
| autrescations = 
| autresanions = 
| isomères = [[acridine]]
<!-- Supplément -->
| supplement = 
}}<!-- ----------------------------- Fin de l'infoboite ----------------------------- -->
La '''phénanthridine''' est un [[composé organique]] du groupe des [[hétérocycle]]s contenant de l'[[azote]]. Elle correspond à un [[phénanthrène]] substitué par un [[atome]] d'azote en position 9. Des dérivés de la phénanthridine sont produits naturellement par exemple par des espèces végétales dans la sous-famille des ''[[Amaryllidoideae]]'' appartenant à la famille des ''[[Amaryllidaceae]]''.

== Synthèse ==
La phénanthridine a été synthétisée pour la première fois en 1889 par {{lien|Amé Jules Pictet|lang=de|trad=Amé Jules Pictet }} et [[H. Jan Ankersmit]] et par [[pyrolyse]] dans un tube incandescent de {{lien|benzalaniline|lang=de|trad=Benzalanilin}}, [[réaction de condensation|produit de condensation]] de [[benzaldéhyde]] et d'[[aniline]]<ref>Amé Pictet, H. J. Ankersmit, ''Mittheilung Ueber das Phenanthridin'', [[Justus Liebigs Annalen der Chemie]], 1889, vol. 266(1-2), pp. 138-153. {{DOI|10.1002/jlac.18912660107}}.</ref>.

Dans la réaction de Pictet-Hubert (1899) le composé est formé dans une réaction d'un [[adduit]] de {{Lien|trad=2-Aminobiphenyl|langue=de|fr=2-aminobiphényl}}-[[formaldéhyde]] (une N-acyl-o-xénylamine) avec du [[chlorure de zinc]] à de hautes températures<ref>Amé Pictet, A. Hubert, ''Mittheilungen Ueber eine neue Synthese der Phenanthridinbasen'', [[Berichte der deutschen chemischen Gesellschaft]], 1896, vol. 29(2), pp. 1182–1189. ({{DOI|10.1002/cber.18960290206}}).</ref>. Les conditions de la réaction de Pictet-Hubert ont été améliorées par {{Lien|trad=Gilbert Thomas Morgan|langue=de|fr=Gilbert Thomas Morgan|texte=Morgan}} et Walls en 1931, en remplaçant le zinc par l'[[oxychlorure de phosphore]], POCl<sub>3</sub> et en utilisant du [[nitrobenzène]] comme [[solvant]]<ref>Gilbert T. Morgan, Leslie Percy Walls, ''CCCXXXV.—Researches in the phenanthridine series. Part I. A new synthesis of phenanthridine homologues and derivatives'', [[J. Chem. Soc.]], 1931, pp. 2447–2456. ({{DOI|10.1039/JR9310002447}}).</ref>. Pour cette raison, la réaction est également appelée réaction de Morgan–Walls<ref>Jie Jack Li, ''Name Reactions in Heterocyclic Chemistry.'', {{1re}} Ed., 2005. {{ISBN|0-471-30215-5}}.</ref> :
:[[Image:Pictet-Hubert reaction V1.svg|500px|none|Réaction de Pictet-Hubert]]

Cette réaction est similaire à la [[réaction de Bischler-Napieralski]] et à la [[réaction de Pictet-Spengler]]. La production de phénanthridine à partir de phénanthraquinone, N-méthyl [[carbazole]], fluorénonoxime ou phénanthridone est possible<ref>C. F. Allen, Lindsey Allen, Richard Allen, ''The Chemistry of Heterocyclic Compounds, Six Membered Heterocyclic Nitrogen''. {{ISBN|978-0-470-37851-9}}.</ref>.

À partir de [[benzyl]][[aryl]][[Amine (chimie)|amine]]s halogénées, la phénanthridine et de ses dérivés peuvent être synthétisés via des intermédiaires [[aryne]]s<ref>S. V. Kessar, {{pdf}} ''[http://www.ias.ac.in/jarch/chemsci/100/00000226.pdf Some new aspects of benzyne and radical mediated cyclisations.]'', Journal of Chemical Sciences, 1988, vol. 100, {{n°}} 2–3, pp. 217–222.</ref> :
: [[Image:Phenanthridine via arynes.svg|500px|none]]

== Utilisation ==
La phénanthridine constitue la structure de base de certains [[alcaloïde]]s, par ex. la fagaronine qui est une hydrobenzo[c]phénanthridine, des [[médicament]]s, par ex. l'[[isométamidium]] et d'autres composés chimiques comme le [[dihydroéthidium]], un marqueur fluorescent.

== Sécurité ==
La phénanthridine serait [[mutagène]]<ref name=P/>.

== Notes et références ==
{{traduction/Référence|de|Phenanthridin|136889621}}
{{Références}}

{{Portail|chimie}}

[[Catégorie:Phénanthridine|*]]