Voir la source de Phtalate de dibutyle

{{Voir homonymes|DBP}}
{{Infobox Chimie
| nom = Phtalate de dibutyle
| image = Dibutyl_phthalate.svg
| image2 = Dibutyl_phthalate_3D_balls.png
| taille image = 200
| légende = 
<!-- Général -->
| DCI = 
| nomIUPAC = benzène-1,2-dicarboxylate de dibutyle
| nomSystematique = 
| synonymes = 
| CAS = {{CAS|84-74-2}}
| EINECS = {{EINECS|201-557-4}}
| RTECS = {{RTECS|TI0875000}}
| ATC = {{ATC|P03BX03}} {{ATCvet|}}
| DrugBank = 
| PubChem = {{CID|3026}}{{SID|}}
| chEBI = 34687
| NrE = {{NrE|}}
| FEMA = {{FEMA|}}
| SMILES = CCCCOC(=O)c1ccccc1C(=O)OCCCC
| InChI = 1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3
| InChIKey = DOIRQSBPFJWKBE-UHFFFAOYSA-N
| StdInChI = 
| StdInChIKey =
| apparence = liquide huileux incolore à jaune pâle avec une légère odeur aromatique caractéristique<ref name=P>{{en}} PubChem CID{{CID|3026}}</ref>{{,}}<ref name=G>{{GESTIS|Nom=Dibutyl phthalate|Date=23 août 2015|ZVG=21620|CAS=84-74-2}}</ref>
<!-- Propriétés chimiques -->
| formule = |C=16|H=22|O=4
| masseMol = 
| pKa = {{pKa||T(°C)=|T(K)=}}
| momentDipolaire = {{unité/2||D}}
| susceptibiliteMagnetique = 
| diametreMoleculaire = {{unité/2||nm}}
| indiceIode = 
| indiceAcide = 
| indiceSaponification = 
<!-- Propriétés physiques -->
| TTransitionVitreuse = {{tmp||°C}}
| fusion = {{tmp|-35|°C}}<ref name=P/>{{,}}<ref name=G/>{{,}}<ref name=S/>
| ebullition = {{tmp|340|°C}}<ref name=P/>{{,}}<ref name=G/>{{,}}<ref name=S>{{Sigma-Aldrich|Aldrich|524980|Nom=Dibutyl phthalate 99%|Date= 23 août 2015}}</ref>
| solubilite = {{Unité/2|11.2-11.5|mg||l|-1}} à {{tmp|25|°C}}<ref name=G/>{{,}}<ref name=C/>	
| masseVolumique = {{Unité/2|1.0459-1.0465|g||cm|-3}}<ref name=P/><br>{{Unité/2|1.043|g||cm|-3}} à {{tmp|25|°C}}<ref name=S/>
| TAutoInflammation = {{tmp|402|°C}}<ref name=P/>
| pointEclair = {{tmp|157|°C}}<ref name=P/>{{,}}<ref name=G/><br>{{tmp|171|°C}}<ref name=S/>
| limitesExplosivite = 
| pressionVapeur = {{unité|2.01|e=-5|[[millimètre de mercure|mmHg]]}} à {{tmp|25|°C}}<ref name=P/>
| viscosite = 0,203 [[poise]] à {{tmp|20|°C}}<ref name=P/>
| pointCritique = 
| pointTriple = 
| conductivitéThermique = {{Unité/2||W||m|-1|K|-1}}
| conductivitéÉlectrique = 
| vitesseSon = {{Unité/2||m||s|-1}}
<!-- Thermochimie -->
| emsGaz = {{Unité/2||J||K|-1|mol|-1}}
| emsLiquide = {{Unité/2||J||K|-1|mol|-1}}
| emsSolide = {{Unité/2||J||K|-1|mol|-1}}
| esfGaz = {{Unité/2||kJ||mol|-1}}
| esfLiquide = {{Unité/2||kJ||mol|-1}}
| esfSolide = {{Unité/2||kJ||mol|-1}}
| enthFus = 
| enthVap = 
| capaciteTherm = {{Unité/2||J||K|-1|mol|-1}}
| PCS = 
| PCI = 
<!-- Propriétés biochimiques -->
| codons = 
| pHisoelectrique = 
| acideAmineEss = 
<!-- Propriétés électroniques -->
| bandeInterdite = 
| mobiliteElectronique = 
| mobiliteTrous = 
| 1reEnergieIonisation = 
| constanteDielectrique = 
<!-- Cristallographie -->
| systemeCristallin = 
| reseauBravais = 
| Pearson = {{SymbolePearson|}}
| classe =
| Schoenflies = 
| Strukturbericht = 
| structureType = 
| parametresMaille = 
| volume = 
| macle = 
<!-- Propriétés optiques -->
| refraction = <!--<math>\textit{n}_{D}^{20}</math> = -->{{réfraction|T=|?=|}}
| birefringence = 
| dispersion = 
| polychroisme = 
| fluorescence = <!-- ?<sub>excitation</sub> {{?||nm}} ; <br />?<sub>émission</sub> {{?||nm}} -->
| absorption = 
| transparence = 
| pvrRotatoire = <!--<math>\lbrack\alpha\rbrack_{D}^{25}</math>-->
| cteVerdet = 
<!-- Précautions -->
| 67548EECref = 
| symboles = T, N
| numeroIndex = {{indexCE|}}
| classificationCE = 
| r = R50, R61, R62
| s = S45, S53, S61
| transportRef = <ref name=G/>{{,}}<ref name=S/>
| transport = {{ADR|Kemler=|ONU=3082|Classe=9|CodeClassification=|Etiquette=|Etiquette2=|Etiquette3=|Emballage=III}}
| NFPA704ref = 
| NFPA704 = {{NFPA 704|Health=|Flammability=|Reactivity=|Other=}}
| SIMDUTref = 
| SIMDUT = {{SIMDUT|}}
| SGHref = <ref name=G/>{{,}}<ref name=S/>
| SGH = {{SGH|SGH08|SGH09|H360Df|H400|P201|P273|P308+P313}}
| CIRC = 
| inhalation = 
| peau = 
| yeux = 
| ingestion = 
<!-- Écotoxicologie -->
| DL50 = 10 000 mg/kg (cochon d'Inde, [[Ingestion|oral]])<ref name=C>{{ChemID|84-74-2|Dibutyl phthalate}}.</ref> <br />3 474 mg/kg (souris, [[Ingestion|oral]])<ref name=C/> <br /> 720 mg/kg (souris, [[Injection intraveineuse|i.v.]])<ref name=C/><br />3 570 mg/kg (souris, [[intrapéritonéal|i.p.]])<ref name=C/><br /> 20 ml/kg (lapin, [[cutané|peau]])<br />7 499 mg/kg (rat, [[Ingestion|oral]])<ref name=C/> <br /> 3,05 ml/kg (rat, [[intrapéritonéal|i.p.]])<ref name=C/><br /> 8 000 mg/kg (rat, [[Injection intramusculaire|i.m.]])<ref name=C/>
| CL50 = {{nb|25 mg/m3}} pour 2 h (souris, [[inhalation]])<ref name=C/><br />{{nb|4250 mg/m3}} (rat, [[inhalation]])<ref name=C/>
| LogP = ([[octanol]]/eau) 4,5<ref name=C/> <br /> 4,72<ref name=G/>
| DJA = 0,01 mg/kg par jour<ref name="djt">{{Lien web | lang=en|titre=Phthalates in school supplies| éditeur=GreenFacts Website | consulté le=2009-06-10 | url= http://copublications.greenfacts.org/en/phthalates-school-supplies/}}</ref>
| odorat = 
<!-- Classe thérapeutique -->
| classeTherapeutique = 
<!-- Données pharmacocinétiques -->
| CAM = 
| biodisponibilite = 
| liaisonProteique = 
| metabolisme = 
| demiVieDistrib = 
| demiVieElim = 
| stockage = 
| excretion = 
<!-- Considérations thérapeutiques -->
| voieAdministration = 
| grossesse = 
| conduiteAuto = 
| precautions = 
| antidote = 
<!-- Caractère psychotrope -->
| categoriePsycho = 
| modeConsommation = 
| autresNoms = 
| risqueDependance = 
<!-- Composés apparentés -->
| autres = 
| autrescations = 
| autresanions = 
| isomères = 
<!-- Supplément -->
| supplement = 
}}<!-- ----------------------------- Fin de l'infoboite ----------------------------- -->

Le '''phtalate de dibutyle''' (nommé couramment DBP) est un [[composé organique]] qui consiste en l'[[ester]] [[Butyl|''n''-butylique]] de l'[[acide phtalique]]. Il est souvent utilisé comme [[plastifiant]]. Il est également employé comme [[additif]] pour les [[adhésif]]s ou les encres d'impressions. Il est soluble dans différents [[Solvant#Selon leur nature chimique|solvants organiques]], par exemple dans l'[[éthanol]], l'[[éther diéthylique]] et le [[benzène]].

== Production ==
Cette molécule est produite par la réaction du [[n-Butanol|''n''-butanol]] avec l'[[anhydride phtalique]]. Ce composé est ou était produit aux États-Unis par [[Eastman Chemical Company]], mais la compagnie annonce en {{date-|mars 2011}} qu'elle veut arrêter la production d'ici {{date-|décembre 2011}}<ref>{{Lien web | lang=en|url = http://www.eastman.com/Company/News_Center/2011/Pages/Eastman_Announces_Discontinuation_of_Manufacture_of_DEP_and_DBP_Plasticizers.aspx | titre = Eastman Announces Discontinuation of Manufacture of DEP and DBP Plasticizers
| jour = 16 | mois = mars | année = 2011 | éditeur = Eastman}}</ref>.

== Exposition ==
En se basant sur des échantillons d'urine de personnes de différents âges, la Commission européenne [[Scientific Committee on Health and Environmental Risks]] (SCHER) a conclu que des efforts devaient être faits pour réduire l'exposition au DBP, une partie significative de la population étant exposée à des absorptions supérieures à la [[dose journalière tolérable]]<ref>{{citation étrangère|langue=en| In the case of the other phthalates assessed by the EU Risk Assessment reports, calculated exposures are below the tolerable level except for DBP. A significant portion of the population may be exposed to doses of DBP above the TDI and efforts to further reduce exposures are needed.}} sur {{Lien web | lang=en|titre=Phthalates in school supplies| éditeur=GreenFacts Website | consulté le=2009-06-10 | url= http://copublications.greenfacts.org/en/phthalates-school-supplies/}}</ref>.

== Contrôle législatif ==
=== Union européenne ===
L'utilisation de cette substance dans les cosmétiques, y compris les vernis à ongles, est interdite dans l'[[Union européenne]] sous la directive 76/768/EEC 1976<ref>{{en}} [http://eur-lex.europa.eu/LexUriServ/LexUriServ.do?uri=CELEX:31976L0768:EN:HTML ''EU Council Directive 76/768/EEC of 27 July 1976 on the approximation of the laws of the Member States relating to cosmetic products'']</ref>.

L'utilisation du DBP est limitée dans la fabrication des jouets pour enfants dans l'Union européenne depuis 1999<ref>{{en}} [http://europa.eu/rapid/pressReleasesAction.do?reference=IP/99/829&format=HTML&aged=1&language=EN&guiLanguage=en ''Ban of phthalates in childcare articles and toys''], communiqué de presse IP/99/829, 10 novembre 1999</ref>.

=== États-Unis ===
Le DBP a été ajouté à la liste de la [[California Proposition 65]] ([[1986]]) des produits suspectés d'être [[Tératologie|tératogènes]] en novembre [[2006]]. Il est suspecté d'être un [[perturbateur endocrinien]]. Il était utilisé dans quelques vernis à ongles, mais depuis 2006, tous les fabricants ont supprimé ce composant de leurs produits.

Le DBP a été banni de manière permanente des jouets pour enfants, pour des concentrations de {{unité/2|1000|ppm}} ou plus, sous le régime de la section 108 du [[Consumer Product Safety Improvement Act]] de [[2008]] (CPSIA).

== Sécurité ==
La [[dose toxique minimale]] (TD{{ind|Lo}}) (humain, [[Ingestion|oral]]) vaut 140&nbsp;mg/kg<ref name=C/>. La [[dose journalière tolérable]] fixée par la [[Commission européenne]] est de {{unité|0.01|mg/kg}} de masse corporelle par jour<ref name="djt"/>.

== Biodégradation ==
Le champignon ''[[Polyporus brumalis]]'' dégrade le DBP<ref>{{Ouvrage|langue=en|auteur1=Muhammad Ishtiaq Ali|titre=Microbial degradation of polyvinyl chloride plastics|lieu=Islamabad|éditeur=Quaid-i-Azam University|année=2009|format=pdf|isbn=|lire en ligne=http://prr.hec.gov.pk/Thesis/3362H.pdf}}{{Commentaire biblio|(thèse)}}</ref>.

== Notes et références ==
{{Traduction/Référence|en|Dibutyl phthalate|673768636}}
{{Références}}

== Voir aussi ==
=== Articles connexes ===
* [[Phtalate de benzyle et de butyle]]
* [[Phtalate de diisobutyle]] (DIBP)

=== Liens externes ===
* {{ICSC|84-74-2}}
* [http://www.phthalates.org/pcp_info_sheet.asp ''Dibutyl Phthalate and Cosmetics'']
* [http://nj.gov/health/eoh/rtkweb/documents/fs/0773.pdf ''Hazardous substance fact sheet'']
* [http://www.osha.gov/SLTC/healthguidelines/dibutylphthalate/recognition.html ''Occupational safety and health guideline for dibutyl phthalate'']
* [https://www.cdc.gov/niosh/npg/npgd0187.html CDC - NIOSH ''Pocket Guide to Chemical Hazards'']

{{Portail|chimie|écotoxicologie}}

[[Catégorie:Plastifiant]]
[[Catégorie:Perturbateur endocrinien]]
[[Catégorie:Phtalate]]