Voir la source de Thymidine-diphosphate-glucose

{{Infobox Chimie
| nom = Thymidine-diphosphate-glucose
| image = 
| image2 = 
| taille image = 200
| légende = [[Fichier:Thymidine diphosphate glucose.png|260px]]<br>Structure du TDP-glucose
<!-- Général -->
| DCI = 
| nomIUPAC = [hydroxy-<nowiki>[[</nowiki>(2R,3S,5R)-3-hydroxy-5-(5-méthyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]méthoxy]phosphoryl]
[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxyméthyl)oxan-2-yl]hydrogène phosphate
| synonymes = dTDP-glucose
| CAS = {{CAS|2|1|9|6|6|2|5}}
| EINECS = {{EINECS|}}
| RTECS = {{RTECS|}}
| ATC = {{ATC|}} {{ATCvet|}}
| DrugBank = 
| PubChem = {{CID|443210}}{{SID|}}
| chEBI = 15700
| NrE = {{NrE|}}
| FEMA = {{FEMA|}}
| SMILES = CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)COP(=O)(O)OP(=O)(O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O
| InChI = 
| InChIKey = 
| StdInChI = 1S/C16H26N2O16P2/c1-6-3-18(16(25)17-14(6)24)10-2-7(20)9(31-10)5-30-35(26,27)34-36(28,29)33-15-13(23)12(22)11(21)8(4-19)32-15/h3,7-13,15,19-23H,2,4-5H2,1H3,(H,26,27)(H,28,29)(H,17,24,25)/t7-,8+,9+,10+,11+,12-,13+,15+/m0/s1
| StdInChIKey = YSYKRGRSMLTJNL-URARBOGNSA-N
| apparence = 
<!-- Propriétés chimiques -->
| formule = |C=16|H=26|N=2|O=16|P=2
| masseMol = 
| pKa = {{pKa||T(°C)=|T(K)=}}
| momentDipolaire = {{unité/2||D}}
| susceptibiliteMagnetique = 
| diametreMoleculaire = {{unité/2||nm}}
| indiceIode = 
| indiceAcide = 
| indiceSaponification = 
<!-- Propriétés physiques -->
| TTransitionVitreuse = {{température||°C}}
| fusion = {{température||°C}}
| ebullition = {{température||°C}}
| solubilite = {{Unité/2||g||l|-1}}
| miscibilite = 
| masseVolumique = {{Unité/2||g||cm|-3}}
| TAutoInflammation = {{température||°C}}
| pointEclair = {{température||°C}}
| limitesExplosivite = 
| pressionVapeur = 
| viscosite = 
| pointCritique = 
| pointTriple = 
| conductivitéThermique = {{Unité/2||W||m|-1|K|-1}}
| conductivitéÉlectrique = 
| vitesseSon = {{Unité/2||m||s|-1}}
<!-- Thermochimie -->
| emsGaz = {{Unité/2||J||K|-1|mol|-1}}
| emsLiquide = {{Unité/2||J||K|-1|mol|-1}}
| emsSolide = {{Unité/2||J||K|-1|mol|-1}}
| esfGaz = {{Unité/2||kJ||mol|-1}}
| esfLiquide = {{Unité/2||kJ||mol|-1}}
| esfSolide = {{Unité/2||kJ||mol|-1}}
| enthFus = 
| enthVap = 
| capaciteTherm = {{Unité/2||J||K|-1|mol|-1}}
| PCS = 
| PCI = 
<!-- Propriétés biochimiques -->
| codons = 
| pHisoelectrique = 
| acideAmineEss = 
<!-- Propriétés électroniques -->
| bandeInterdite = 
| mobiliteElectronique = 
| mobiliteTrous = 
| 1reEnergieIonisation = 
| constanteDielectrique = 
<!-- Cristallographie -->
| systemeCristallin = 
| reseauBravais = 
| Pearson = {{SymbolePearson|}}
| classe =
{{Infobox Chimie/Groupe espace||ref=}}
| Schoenflies = 
| Strukturbericht = 
| structureType = 
| parametresMaille = 
| volume = 
| macle = 
<!-- Propriétés optiques -->
| refraction = {{réfraction|T=|λ=|}}
| birefringence = 
| dispersion = 
| polychroisme = 
| fluorescence = <!-- λ<sub>excitation</sub> {{λ||nm}};<br />λ<sub>émission</sub> {{λ||nm}} -->
| absorption = 
| transparence = 
| pvrRotatoire = <!--<math>\lbrack\alpha\rbrack_{D}^{25}</math>-->
| cteVerdet = 
<!-- Précautions -->
| radioactif = 
| 67548EEC = 
| 67548EECref = 
| symboles = 
| numeroIndex = {{indexCE|}}
| classificationCE = 
| r = 
| s = 
| transportRef = 
| transport = {{ADR|Kemler=|ONU=|Classe=|CodeClassification=|Etiquette=|Etiquette2=|Etiquette3=|Emballage=}}
| NFPA704ref = 
| NFPA704 = {{NFPA 704|Health=|Flammability=|Reactivity=|Other=}}
| SIMDUTref = 
| SIMDUT = {{SIMDUT|}}
| SGHref = 
| SGH = {{SGH|}}
| CIRC = 
| inhalation = 
| peau = 
| yeux = 
| ingestion = 
<!-- Écotoxicologie -->
| DL50 = <!-- (souris, [[Ingestion|oral]]) <br /> (souris, [[Injection intraveineuse|i.v.]]) <br /> (souris, [[sous-cutané|s.c.]]) <br /> (souris, [[intrapéritonéal|i.p.]]) -->
| CL50 = 
| LogP = 
| DJA = 
| odorat = 
<!-- Données pharmacocinétiques -->
| CAM = 
| biodisponibilite = 
| liaisonProteique = 
| metabolisme = 
| demiVieDistrib = 
| demiVieElim = 
| stockage = 
| excretion = 
<!-- Considérations thérapeutiques -->
| classeTherapeutique = 
| voieAdministration = 
| grossesse = 
| conduiteAuto = 
| precautions = 
| antidote = 
<!-- Caractère psychotrope -->
| categoriePsycho = 
| modeConsommation = 
| autresNoms = 
| risqueDependance = 
<!-- Composés apparentés -->
| autres = 
| autrescations = 
| autresanions = 
| isomères = 
<!-- Supplément -->
| supplement = 
}}<!-- ----------------------------- Fin de l'infoboite ----------------------------- -->
Le '''thymidine-diphosphate-glucose''' ('''TDP-glucose'''), ou '''désoxythymidine-diphosphate-glucose''' ('''dTDP-glucose'''), est un [[nucléotide-ose]] constitué de désoxy[[thymidine diphosphate]] et de [[glucose]]. C'est le point de départ de la [[biosynthèse]] de nombreux [[désoxyose]]s<ref name="10.1146/annurev.biochem.71.110601.135339">
{{Article
 | langue      = en
 | nom1        = Xuemei M. He et Hung-wen Liu
 | titre       = FORMATION OF UNUSUAL SUGARS: Mechanistic Studies and Biosynthetic Applications
 | périodique  = Annual Review of Biochemistry
 | volume      = 71
 | numéro      = 
 | jour        = 
 | mois        = juillet
 | année       = 2002
 | pages       = 701-754
 | url texte   = http://www.annualreviews.org/doi/pdf/10.1146/annurev.biochem.71.110601.135339
 | consulté le = 22 juillet 2012
}} {{DOI|10.1146/annurev.biochem.71.110601.135339}} {{PMID|12045109}}</ref>.

== Notes et références ==

{{Références}}

{{Portail|chimie|biochimie}}

[[Catégorie:Nucléotide]]
[[Catégorie:Pyrimidinedione]]